CAS 70887-88-6 appears in our catalog under these names: 2H-Perfluoro-2-octenoic Acid, >95% (HPLC), 2H-Perfluoro-2-octenoic acid, 2H-Perfluoro-2-octenoic acid 100 µg/mL in Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 10mg, 1mg, 5mg, 50mg, 1ml.
3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-2-enoic acid (CAS 70887-88-6) is a chemical compound with the molecular formula C8H2F12O2 and a molecular weight of 358.08 g/mol. IUPAC name: 3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-2-enoic acid. InChIKey: BKOBFLVYTXYFQZ-UHFFFAOYSA-N.
| Molecular formula | C8H2F12O2 |
|---|---|
| Molecular weight | 358.08 g/mol |
| IUPAC name | 3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-2-enoic acid |
| InChIKey | BKOBFLVYTXYFQZ-UHFFFAOYSA-N |
| SMILES | C(=C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)