Products 26153-26-4
CAS 26153-26-4 is the registry number for 2-(Naphthalen-1-yl)-2-oxoacetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-naphthalen-1-yl-2-oxoacetic acid (CAS 26153-26-4) is a chemical compound with the molecular formula C12H8O3 and a molecular weight of 200.19 g/mol. IUPAC name: 2-naphthalen-1-yl-2-oxoacetic acid. InChIKey: ACXGUQLILSWMPT-UHFFFAOYSA-N.
| Molecular formula | C12H8O3 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 2-naphthalen-1-yl-2-oxoacetic acid |
| InChIKey | ACXGUQLILSWMPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Naphthalenyl oxoacetic acid, 2-(naphthalen-1-yl)-2-oxoacetic acid, 2-naphthalen-1-yl-2-oxoacetic acid, 1-naphthylglyoxylic acid, 1-Naphthaleneacetic acid, alpha-oxo-, 1-Naphthyl(oxo)acetic acid #, ACXGUQLILSWMPT-UHFFFAOYSA-N, 1-Naphthaleneacetic acid, ?-oxo-, (Naphthalen-1-yl)(oxo)acetic acid, 1-Naphthaleneacetic acid, |A-oxo-