CAS 37845-14-0 appears in our catalog under these names: 3,4-Dihydro-1,2-naphthalenedicarboxylic anhydride, 95%, 4,5-Dihydronaphtho(1,2-c)furan-1,3-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
4,5-dihydrobenzo[e][2]benzofuran-1,3-dione (CAS 37845-14-0) is a chemical compound with the molecular formula C12H8O3 and a molecular weight of 200.19 g/mol. IUPAC name: 4,5-dihydrobenzo[e][2]benzofuran-1,3-dione. InChIKey: FSVOMBDSHMMPER-UHFFFAOYSA-N.
| Molecular formula | C12H8O3 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 4,5-dihydrobenzo[e][2]benzofuran-1,3-dione |
| InChIKey | FSVOMBDSHMMPER-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C31)C(=O)OC2=O |
Computed by PubChem (NCBI)