CAS 5914-48-7 is the registry number for 2,8-Dihydroxydibenzofuran, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
Dibenzofuran-2,8-diol (CAS 5914-48-7) is a chemical compound with the molecular formula C12H8O3 and a molecular weight of 200.19 g/mol. IUPAC name: dibenzofuran-2,8-diol. InChIKey: VXDZJGNEPGPUEG-UHFFFAOYSA-N.
| Molecular formula | C12H8O3 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | dibenzofuran-2,8-diol |
| InChIKey | VXDZJGNEPGPUEG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C3=C(O2)C=CC(=C3)O |
Computed by PubChem (NCBI)