CAS 261728-61-4 appears in our catalog under these names: (2S,3R,4S,5S,6R)-6-(Hydroxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol-2,3-13C2, 98% +98%atom%13C, D-Glucose-1,2-13C2, alpha-D-glucose-13C2-1. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 100 mg, 5 mg, 50 mg, 25 mg, 10 mg.
(3R,4S,5S,6R)-6-(hydroxymethyl)(2,3-13C2)oxane-2,3,4,5-tetrol (CAS 261728-61-4) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 182.14 g/mol. IUPAC name: (3R,4S,5S,6R)-6-(hydroxymethyl)(2,3-13C2)oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-YMLPSEGOSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 182.14 g/mol |
| IUPAC name | (3R,4S,5S,6R)-6-(hydroxymethyl)(2,3-13C2)oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-YMLPSEGOSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([13C@H]([13CH](O1)O)O)O)O)O |
Computed by PubChem (NCBI)