CAS 261763-27-3 appears in our catalog under these names: 2,4-Dichloro-5-fluorobenzyl bromide, 95%, 2,4–Dichloro–5–fluorobenzyl bromide, 2,4-Dichloro-5-fluorobenzyl bromide, 98%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
1-(bromomethyl)-2,4-dichloro-5-fluorobenzene (CAS 261763-27-3) is a chemical compound with the molecular formula C7H4BrCl2F and a molecular weight of 257.91 g/mol. IUPAC name: 1-(bromomethyl)-2,4-dichloro-5-fluorobenzene. InChIKey: SXAZGVVUQUTRIS-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl2F |
|---|---|
| Molecular weight | 257.91 g/mol |
| IUPAC name | 1-(bromomethyl)-2,4-dichloro-5-fluorobenzene |
| InChIKey | SXAZGVVUQUTRIS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Cl)Cl)CBr |
Computed by PubChem (NCBI)