Products 916420-69-4
CAS 916420-69-4 appears in our catalog under these names: 3,6-Dichloro-2-fluorobenzyl bromide, 95%, 2-(Bromomethyl)-1,4-dichloro-3-fluorobenzene 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 250mg.
2-(bromomethyl)-1,4-dichloro-3-fluorobenzene (CAS 916420-69-4) is a chemical compound with the molecular formula C7H4BrCl2F and a molecular weight of 257.91 g/mol. IUPAC name: 2-(bromomethyl)-1,4-dichloro-3-fluorobenzene. InChIKey: RXWLZGRXMKRFEH-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl2F |
|---|---|
| Molecular weight | 257.91 g/mol |
| IUPAC name | 2-(bromomethyl)-1,4-dichloro-3-fluorobenzene |
| InChIKey | RXWLZGRXMKRFEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)CBr)F)Cl |
Computed by PubChem (NCBI)