CAS 886497-51-4 appears in our catalog under these names: 2,3-Dichloro-6-fluorobenzyl bromide, 95%, 2-(Bromomethyl)-3,4-dichloro-1-fluorobenzene 97%, 2-(Bromomethyl)-3,4-dichloro-1-fluorobenzene, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg.
3-(bromomethyl)-1,2-dichloro-4-fluorobenzene (CAS 886497-51-4) is a chemical compound with the molecular formula C7H4BrCl2F and a molecular weight of 257.91 g/mol. IUPAC name: 3-(bromomethyl)-1,2-dichloro-4-fluorobenzene. InChIKey: RXHTVFRUZNHYSD-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl2F |
|---|---|
| Molecular weight | 257.91 g/mol |
| IUPAC name | 3-(bromomethyl)-1,2-dichloro-4-fluorobenzene |
| InChIKey | RXHTVFRUZNHYSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)CBr)Cl)Cl |
Computed by PubChem (NCBI)