CAS 26180-28-9 appears in our catalog under these names: 3-(2,5-Dimethyl-1h-pyrrol-1-yl)benzoic acid, 95%, 3-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 10g, 25g.
3-(2,5-dimethylpyrrol-1-yl)benzoic acid (CAS 26180-28-9) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 3-(2,5-dimethylpyrrol-1-yl)benzoic acid. InChIKey: NJPUZFUOUGTNOV-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 3-(2,5-dimethylpyrrol-1-yl)benzoic acid |
| InChIKey | NJPUZFUOUGTNOV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC=CC(=C2)C(=O)O)C |
Computed by PubChem (NCBI)