CAS 261951-77-3 appears in our catalog under these names: 4-Fluoro-3-methyl-DL-phenylglycine, 97%, 2-((4-Fluoro-3-methylphenyl)amino)acetic acid, 95%, 2-Amino-2-(4-fluoro-3-methylphenyl)acetic acid, 97%. Offered by: Fluorochem, AmBeed, Chemat. Available pack sizes: 100mg, 250mg.
2-amino-2-(4-fluoro-3-methylphenyl)acetic acid (CAS 261951-77-3) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: 2-amino-2-(4-fluoro-3-methylphenyl)acetic acid. InChIKey: QWEDLCFNJKCNNU-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 2-amino-2-(4-fluoro-3-methylphenyl)acetic acid |
| InChIKey | QWEDLCFNJKCNNU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C(=O)O)N)F |
Computed by PubChem (NCBI)