CAS 261959-19-7 is the registry number for 2-(3-Chlorophenoxy)-n-hydroxyethanimidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
2-(3-chlorophenoxy)-N'-hydroxyethanimidamide (CAS 261959-19-7) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 2-(3-chlorophenoxy)-N'-hydroxyethanimidamide. InChIKey: UFJNDLYGDWVOFJ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-(3-chlorophenoxy)-N'-hydroxyethanimidamide |
| InChIKey | UFJNDLYGDWVOFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OC/C(=N/O)/N |
Computed by PubChem (NCBI)