CAS 26198-80-1 appears in our catalog under these names: 1a,1b–dihomo Prostaglandin E2, 1a,1b-dihomo Prostaglandin E2. Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 500ug, 500μg, 25mg, 10mg, 1 mg, 5 mg.
(Z)-9-[(2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]non-7-enoic acid (CAS 26198-80-1) is a chemical compound with the molecular formula C22H36O5 and a molecular weight of 380.5 g/mol. IUPAC name: (Z)-9-[(2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]non-7-enoic acid. InChIKey: PNKJEXAWAIJTRO-ULHTUUQVSA-N.
| Molecular formula | C22H36O5 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | (Z)-9-[(2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]non-7-enoic acid |
| InChIKey | PNKJEXAWAIJTRO-ULHTUUQVSA-N |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@@H](CC(=O)C1C/C=C\CCCCCC(=O)O)O)O |
Computed by PubChem (NCBI)