CAS 81026-63-3 appears in our catalog under these names: Enisoprost, SC 34301. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, Get quote.
Methyl (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]hept-4-enoate (CAS 81026-63-3) is a chemical compound with the molecular formula C22H36O5 and a molecular weight of 380.5 g/mol. IUPAC name: methyl (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]hept-4-enoate. InChIKey: CIBHDGPIOICRGX-ZQCHCGQNSA-N.
| Molecular formula | C22H36O5 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | methyl (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]hept-4-enoate |
| InChIKey | CIBHDGPIOICRGX-ZQCHCGQNSA-N |
| SMILES | CCCCC(C)(C/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1CC/C=C\CCC(=O)OC)O)O |
Computed by PubChem (NCBI)