CAS 42302-24-9 appears in our catalog under these names: Dihydropleuromutilin, >95% (HPLC), Dihydropleuromutilin. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 25mg, 5mg, 5 mg, 1 mg, 10 mg, 25 mg.
[(2R,3S,4R,6R,8R,14R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate (CAS 42302-24-9) is a chemical compound with the molecular formula C22H36O5 and a molecular weight of 380.5 g/mol. IUPAC name: [(2R,3S,4R,6R,8R,14R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate. InChIKey: RTOIPDPHQXGIRG-JKZASVEESA-N.
| Molecular formula | C22H36O5 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | [(2R,3S,4R,6R,8R,14R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate |
| InChIKey | RTOIPDPHQXGIRG-JKZASVEESA-N |
| SMILES | CC[C@@]1(C[C@H](C2([C@@H](CCC3([C@H]2C(=O)CC3)[C@H]([C@@H]1O)C)C)C)OC(=O)CO)C |
Computed by PubChem (NCBI)