Products 2621934-76-5

CAS 2621934-76-5 is the registry number for 1-Benzyl 2-methyl 2-(3-ethoxy-3-oxopropyl)pyrrolidine-1,2-dicarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-benzyl 2-O-methyl 2-(3-ethoxy-3-oxopropyl)pyrrolidine-1,2-dicarboxylate (CAS 2621934-76-5) is a chemical compound with the molecular formula C19H25NO6 and a molecular weight of 363.4 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl 2-(3-ethoxy-3-oxopropyl)pyrrolidine-1,2-dicarboxylate. InChIKey: STEQHZZWCFRQTL-UHFFFAOYSA-N.

Identity
Molecular formulaC19H25NO6
Molecular weight363.4 g/mol
IUPAC name1-O-benzyl 2-O-methyl 2-(3-ethoxy-3-oxopropyl)pyrrolidine-1,2-dicarboxylate
InChIKeySTEQHZZWCFRQTL-UHFFFAOYSA-N
SMILESCCOC(=O)CCC1(CCCN1C(=O)OCC2=CC=CC=C2)C(=O)OC

Computed by PubChem (NCBI)