Products 2756181-06-1

CAS 2756181-06-1 is the registry number for 1-Benzyl 3-ethyl 3-(2-ethoxy-2-oxoethyl)pyrrolidine-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

1-O-benzyl 3-O-ethyl 3-(2-ethoxy-2-oxoethyl)pyrrolidine-1,3-dicarboxylate (CAS 2756181-06-1) is a chemical compound with the molecular formula C19H25NO6 and a molecular weight of 363.4 g/mol. IUPAC name: 1-O-benzyl 3-O-ethyl 3-(2-ethoxy-2-oxoethyl)pyrrolidine-1,3-dicarboxylate. InChIKey: TZVUKGIKWYCTCD-UHFFFAOYSA-N.

Identity
Molecular formulaC19H25NO6
Molecular weight363.4 g/mol
IUPAC name1-O-benzyl 3-O-ethyl 3-(2-ethoxy-2-oxoethyl)pyrrolidine-1,3-dicarboxylate
InChIKeyTZVUKGIKWYCTCD-UHFFFAOYSA-N
SMILESCCOC(=O)CC1(CCN(C1)C(=O)OCC2=CC=CC=C2)C(=O)OCC

Computed by PubChem (NCBI)