Products 74332-55-1

CAS 74332-55-1 is the registry number for Menbutone Diethanolamine Salt. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-hydroxyethylamino)ethanol;4-(4-methoxynaphthalen-1-yl)-4-oxobutanoic acid (CAS 74332-55-1) is a chemical compound with the molecular formula C19H25NO6 and a molecular weight of 363.4 g/mol. IUPAC name: 2-(2-hydroxyethylamino)ethanol;4-(4-methoxynaphthalen-1-yl)-4-oxobutanoic acid. InChIKey: NYBYAEQEGMYBOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC19H25NO6
Molecular weight363.4 g/mol
IUPAC name2-(2-hydroxyethylamino)ethanol;4-(4-methoxynaphthalen-1-yl)-4-oxobutanoic acid
InChIKeyNYBYAEQEGMYBOZ-UHFFFAOYSA-N
SMILESCOC1=CC=C(C2=CC=CC=C21)C(=O)CCC(=O)O.C(CO)NCCO

Computed by PubChem (NCBI)