Products 2623101-32-4
CAS 2623101-32-4 is the registry number for 3-(6-Bromo-3-benzofuranyl)-2,6-piperidinedione, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-(6-bromo-1-benzofuran-3-yl)piperidine-2,6-dione (CAS 2623101-32-4) is a chemical compound with the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. IUPAC name: 3-(6-bromo-1-benzofuran-3-yl)piperidine-2,6-dione. InChIKey: LPVNCNJIZWIBEW-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO3 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 3-(6-bromo-1-benzofuran-3-yl)piperidine-2,6-dione |
| InChIKey | LPVNCNJIZWIBEW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=COC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)