CAS 2623101-33-5 appears in our catalog under these names: 3-(5-Bromobenzofuran-3-yl)piperidine-2,6-dione, 95%, 95%, CRBN ligand-890, 96.74%, 3-(5-bromobenzofuran-3-yl)piperidine-2,6-dione, 97%, 3-(5-Bromobenzofuran-3-yl)piperidine-2,6-dione, 95%. Offered by: Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25 mg, 50 mg, 100 mg.
3-(5-bromo-1-benzofuran-3-yl)piperidine-2,6-dione (CAS 2623101-33-5) is a chemical compound with the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. IUPAC name: 3-(5-bromo-1-benzofuran-3-yl)piperidine-2,6-dione. InChIKey: QCXISRYAIOUKIR-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO3 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 3-(5-bromo-1-benzofuran-3-yl)piperidine-2,6-dione |
| InChIKey | QCXISRYAIOUKIR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=COC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)