Products 2624417-74-7
CAS 2624417-74-7 is the registry number for 4-Chloro-2-fluoro-[1,1'-biphenyl]-3-carboxylic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
6-chloro-2-fluoro-3-phenylbenzoic acid (CAS 2624417-74-7) is a chemical compound with the molecular formula C13H8ClFO2 and a molecular weight of 250.65 g/mol. IUPAC name: 6-chloro-2-fluoro-3-phenylbenzoic acid. InChIKey: BVLRWEIEXBEGQA-UHFFFAOYSA-N.
| Molecular formula | C13H8ClFO2 |
|---|---|
| Molecular weight | 250.65 g/mol |
| IUPAC name | 6-chloro-2-fluoro-3-phenylbenzoic acid |
| InChIKey | BVLRWEIEXBEGQA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=C(C=C2)Cl)C(=O)O)F |
Computed by PubChem (NCBI)