Products 2624998-12-3
CAS 2624998-12-3 is the registry number for 4’,5’-Diamino-[1,1’:2’,1’’-terphenyl]-4,4’’-dicarbonitrile, ≥95%. Offered by: Chemat. Available pack sizes: 100mg.
4-[4,5-diamino-2-(4-cyanophenyl)phenyl]benzonitrile (CAS 2624998-12-3) is a chemical compound with the molecular formula C20H14N4 and a molecular weight of 310.4 g/mol. IUPAC name: 4-[4,5-diamino-2-(4-cyanophenyl)phenyl]benzonitrile. InChIKey: CVVYHAOUBOGTIA-UHFFFAOYSA-N.
| Molecular formula | C20H14N4 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 4-[4,5-diamino-2-(4-cyanophenyl)phenyl]benzonitrile |
| InChIKey | CVVYHAOUBOGTIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC(=C(C=C2C3=CC=C(C=C3)C#N)N)N |
Computed by PubChem (NCBI)