CAS 26258-24-2 appears in our catalog under these names: N-{4-[(4-Nitrophenyl)methoxy]phenyl}acetamide, 95%, 95%, N-(4-((4-NITROBENZYL)OXY)PHENYL)ACETAMIDE, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
N-[4-[(4-nitrophenyl)methoxy]phenyl]acetamide (CAS 26258-24-2) is a chemical compound with the molecular formula C15H14N2O4 and a molecular weight of 286.28 g/mol. IUPAC name: N-[4-[(4-nitrophenyl)methoxy]phenyl]acetamide. InChIKey: ANJPFFFWWNXZMT-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O4 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | N-[4-[(4-nitrophenyl)methoxy]phenyl]acetamide |
| InChIKey | ANJPFFFWWNXZMT-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)OCC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)