Products 2626938-18-7
CAS 2626938-18-7 is the registry number for 5-(Dimethylamino)-2-isobutyryl-3-methylpenta-2,4-dienenitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2E,4E)-5-(dimethylamino)-3-methyl-2-(2-methylpropanoyl)penta-2,4-dienenitrile (CAS 2626938-18-7) is a chemical compound with the molecular formula C12H18N2O and a molecular weight of 206.28 g/mol. IUPAC name: (2E,4E)-5-(dimethylamino)-3-methyl-2-(2-methylpropanoyl)penta-2,4-dienenitrile. InChIKey: CRWZAZIFYIMUMC-MVQNEBOGSA-N.
| Molecular formula | C12H18N2O |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | (2E,4E)-5-(dimethylamino)-3-methyl-2-(2-methylpropanoyl)penta-2,4-dienenitrile |
| InChIKey | CRWZAZIFYIMUMC-MVQNEBOGSA-N |
| SMILES | CC(C)C(=O)/C(=C(\C)/C=C/N(C)C)/C#N |
Computed by PubChem (NCBI)