CAS 262862-70-4 appears in our catalog under these names: 4–(4–Chlorophenoxy)benzaldehyde Oxime, 4-(4-Chlorophenoxy)benzaldehyde oxime, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg, 5g.
(NE)-N-[[4-(4-chlorophenoxy)phenyl]methylidene]hydroxylamine (CAS 262862-70-4) is a chemical compound with the molecular formula C13H10ClNO2 and a molecular weight of 247.67 g/mol. IUPAC name: (NE)-N-[[4-(4-chlorophenoxy)phenyl]methylidene]hydroxylamine. InChIKey: XLAAMNHYXQWXPI-OQLLNIDSSA-N.
| Molecular formula | C13H10ClNO2 |
|---|---|
| Molecular weight | 247.67 g/mol |
| IUPAC name | (NE)-N-[[4-(4-chlorophenoxy)phenyl]methylidene]hydroxylamine |
| InChIKey | XLAAMNHYXQWXPI-OQLLNIDSSA-N |
| SMILES | C1=CC(=CC=C1/C=N/O)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)