CAS 263270-40-2 is the registry number for 2–chloro–6–morpholinopyrimidine–4–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
2-chloro-6-morpholin-4-ylpyrimidine-4-carboxylic acid (CAS 263270-40-2) is a chemical compound with the molecular formula C9H10ClN3O3 and a molecular weight of 243.65 g/mol. IUPAC name: 2-chloro-6-morpholin-4-ylpyrimidine-4-carboxylic acid. InChIKey: XKIPJVVPJNLVBS-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O3 |
|---|---|
| Molecular weight | 243.65 g/mol |
| IUPAC name | 2-chloro-6-morpholin-4-ylpyrimidine-4-carboxylic acid |
| InChIKey | XKIPJVVPJNLVBS-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC(=NC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)