CAS 2632968-72-8 appears in our catalog under these names: Glutathione synthesis-IN-1/ 98.1% (existing batch purity), Glutathione synthesis–IN–1, Glutathione synthesis-IN-1 98%, Glutathione synthesis-IN-1, Glutathione synthesis-IN-1, 98.32%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM/1mL.
2-hydroxy-5-[(E)-2-(4-phenylphenyl)ethenyl]benzoic acid (CAS 2632968-72-8) is a chemical compound with the molecular formula C21H16O3 and a molecular weight of 316.3 g/mol. IUPAC name: 2-hydroxy-5-[(E)-2-(4-phenylphenyl)ethenyl]benzoic acid. InChIKey: PTIOBWXSSXHDCF-VOTSOKGWSA-N.
| Molecular formula | C21H16O3 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | 2-hydroxy-5-[(E)-2-(4-phenylphenyl)ethenyl]benzoic acid |
| InChIKey | PTIOBWXSSXHDCF-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)/C=C/C3=CC(=C(C=C3)O)C(=O)O |
Computed by PubChem (NCBI)