Products 2633725-27-4
CAS 2633725-27-4 is the registry number for 1-(4-Hydroxy-2-methylphenyl)dihydropyrimidine-2,4(1H,3H)-dione, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-hydroxy-2-methylphenyl)-1,3-diazinane-2,4-dione (CAS 2633725-27-4) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 1-(4-hydroxy-2-methylphenyl)-1,3-diazinane-2,4-dione. InChIKey: LMCNNJUNVDFRBQ-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 1-(4-hydroxy-2-methylphenyl)-1,3-diazinane-2,4-dione |
| InChIKey | LMCNNJUNVDFRBQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)O)N2CCC(=O)NC2=O |
Computed by PubChem (NCBI)