Products 2634712-11-9
CAS 2634712-11-9 is the registry number for 4-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)pyridine, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (CAS 2634712-11-9) is a chemical compound with the molecular formula C17H20BNO2 and a molecular weight of 281.2 g/mol. IUPAC name: 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine. InChIKey: OWLTVTWCNCTNBJ-UHFFFAOYSA-N.
| Molecular formula | C17H20BNO2 |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| InChIKey | OWLTVTWCNCTNBJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C3=CC=NC=C3 |
Computed by PubChem (NCBI)