CAS 2636094-52-3 is the registry number for 2-(cyclopent-1-en-1-yl)-1,4-dimethylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-(cyclopenten-1-yl)-1,4-dimethylbenzene (CAS 2636094-52-3) is a chemical compound with the molecular formula C13H16 and a molecular weight of 172.27 g/mol. IUPAC name: 2-(cyclopenten-1-yl)-1,4-dimethylbenzene. InChIKey: ZCNLITPGBMMOFZ-UHFFFAOYSA-N.
| Molecular formula | C13H16 |
|---|---|
| Molecular weight | 172.27 g/mol |
| IUPAC name | 2-(cyclopenten-1-yl)-1,4-dimethylbenzene |
| InChIKey | ZCNLITPGBMMOFZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C2=CCCC2 |
Computed by PubChem (NCBI)