CAS 74312-62-2 is the registry number for (2,4-Dimethyl-penta-1,3-dienyl)-benzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1E)-2,4-dimethylpenta-1,3-dienyl]benzene (CAS 74312-62-2) is a chemical compound with the molecular formula C13H16 and a molecular weight of 172.27 g/mol. IUPAC name: [(1E)-2,4-dimethylpenta-1,3-dienyl]benzene. InChIKey: JNYUCBGTSGGRAV-ZRDIBKRKSA-N.
| Molecular formula | C13H16 |
|---|---|
| Molecular weight | 172.27 g/mol |
| IUPAC name | [(1E)-2,4-dimethylpenta-1,3-dienyl]benzene |
| InChIKey | JNYUCBGTSGGRAV-ZRDIBKRKSA-N |
| SMILES | CC(=C/C(=C/C1=CC=CC=C1)/C)C |
Computed by PubChem (NCBI)