CAS 40650-31-5 is the registry number for 1-(tert-Butyl)-1H-indene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-tert-butyl-1H-indene (CAS 40650-31-5) is a chemical compound with the molecular formula C13H16 and a molecular weight of 172.27 g/mol. IUPAC name: 1-tert-butyl-1H-indene. InChIKey: IHHBPJRQKRVWAY-UHFFFAOYSA-N.
| Molecular formula | C13H16 |
|---|---|
| Molecular weight | 172.27 g/mol |
| IUPAC name | 1-tert-butyl-1H-indene |
| InChIKey | IHHBPJRQKRVWAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1C=CC2=CC=CC=C12 |
Computed by PubChem (NCBI)