Products 2637413-50-2

CAS 2637413-50-2 is the registry number for 8-cyclopropylnaphthalene-1-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

8-cyclopropylnaphthalene-1-carboxylic acid (CAS 2637413-50-2) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 8-cyclopropylnaphthalene-1-carboxylic acid. InChIKey: KEOYKBDXIKZZOE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12O2
Molecular weight212.24 g/mol
IUPAC name8-cyclopropylnaphthalene-1-carboxylic acid
InChIKeyKEOYKBDXIKZZOE-UHFFFAOYSA-N
SMILESC1CC1C2=CC=CC3=C2C(=CC=C3)C(=O)O

Computed by PubChem (NCBI)