CAS 2639391-54-9 is the registry number for (S)-2-((methylsulfonyl)methyl)pyrrolidine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(2S)-2-(methylsulfonylmethyl)pyrrolidine;hydrochloride (CAS 2639391-54-9) is a chemical compound with the molecular formula C6H14ClNO2S and a molecular weight of 199.70 g/mol. IUPAC name: (2S)-2-(methylsulfonylmethyl)pyrrolidine;hydrochloride. InChIKey: ZIZDNEXPJSDZTL-RGMNGODLSA-N.
| Molecular formula | C6H14ClNO2S |
|---|---|
| Molecular weight | 199.70 g/mol |
| IUPAC name | (2S)-2-(methylsulfonylmethyl)pyrrolidine;hydrochloride |
| InChIKey | ZIZDNEXPJSDZTL-RGMNGODLSA-N |
| SMILES | CS(=O)(=O)C[C@@H]1CCCN1.Cl |
Computed by PubChem (NCBI)