CAS 2639604-92-3 is the registry number for 6-Fluoro-7-nitrochroman-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-7-nitro-3,4-dihydro-2H-chromen-4-ol (CAS 2639604-92-3) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: 6-fluoro-7-nitro-3,4-dihydro-2H-chromen-4-ol. InChIKey: CHMYBJRQDCOMLI-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | 6-fluoro-7-nitro-3,4-dihydro-2H-chromen-4-ol |
| InChIKey | CHMYBJRQDCOMLI-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=C(C=C2C1O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)