CAS 2640352-99-2 is the registry number for 3-Bromo-4-fluoro-N,5-dimethylbenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-4-fluoro-N,5-dimethylbenzamide (CAS 2640352-99-2) is a chemical compound with the molecular formula C9H9BrFNO and a molecular weight of 246.08 g/mol. IUPAC name: 3-bromo-4-fluoro-N,5-dimethylbenzamide. InChIKey: PTHWSBBUVQXKPM-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 3-bromo-4-fluoro-N,5-dimethylbenzamide |
| InChIKey | PTHWSBBUVQXKPM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)Br)C(=O)NC |
Computed by PubChem (NCBI)