Products 2640732-88-1
CAS 2640732-88-1 is the registry number for 7-Chloro-2-(1-phenylethyl)isoquinolin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-2-(1-phenylethyl)isoquinolin-1-one (CAS 2640732-88-1) is a chemical compound with the molecular formula C17H14ClNO and a molecular weight of 283.7 g/mol. IUPAC name: 7-chloro-2-(1-phenylethyl)isoquinolin-1-one. InChIKey: CBHIARVBMCCONA-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO |
|---|---|
| Molecular weight | 283.7 g/mol |
| IUPAC name | 7-chloro-2-(1-phenylethyl)isoquinolin-1-one |
| InChIKey | CBHIARVBMCCONA-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)N2C=CC3=C(C2=O)C=C(C=C3)Cl |
Computed by PubChem (NCBI)