Products 721892-15-5
CAS 721892-15-5 is the registry number for 2-Chloro-1-(1-methyl-2-phenyl-1H-indol-3-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-1-(1-methyl-2-phenylindol-3-yl)ethanone (CAS 721892-15-5) is a chemical compound with the molecular formula C17H14ClNO and a molecular weight of 283.7 g/mol. IUPAC name: 2-chloro-1-(1-methyl-2-phenylindol-3-yl)ethanone. InChIKey: HOAGPQCXLQZDIU-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO |
|---|---|
| Molecular weight | 283.7 g/mol |
| IUPAC name | 2-chloro-1-(1-methyl-2-phenylindol-3-yl)ethanone |
| InChIKey | HOAGPQCXLQZDIU-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=C1C3=CC=CC=C3)C(=O)CCl |
Computed by PubChem (NCBI)