CAS 92407-86-8 is the registry number for 1-(4-Chlorobenzyl)-2-methyl-1H-indole-3-carbaldehyde. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
1-[(4-chlorophenyl)methyl]-2-methylindole-3-carbaldehyde (CAS 92407-86-8) is a chemical compound with the molecular formula C17H14ClNO and a molecular weight of 283.7 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]-2-methylindole-3-carbaldehyde. InChIKey: GDKIFZJBJKSAOH-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO |
|---|---|
| Molecular weight | 283.7 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]-2-methylindole-3-carbaldehyde |
| InChIKey | GDKIFZJBJKSAOH-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1CC3=CC=C(C=C3)Cl)C=O |
Computed by PubChem (NCBI)