Products 2641451-60-5
CAS 2641451-60-5 appears in our catalog under these names: 3-(5-Bromo-1H-indol-3-yl)-2,2-dimethylpropan-1-ol, 97%, 97%, 3-(5-Bromo-1H-indol-3-yl)-2,2-dimethylpropan-1-ol, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 25g, 100g, 5g, 10g.
3-(5-bromo-1H-indol-3-yl)-2,2-dimethylpropan-1-ol (CAS 2641451-60-5) is a chemical compound with the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. IUPAC name: 3-(5-bromo-1H-indol-3-yl)-2,2-dimethylpropan-1-ol. InChIKey: SQGJRSORSBXTHT-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO |
|---|---|
| Molecular weight | 282.18 g/mol |
| IUPAC name | 3-(5-bromo-1H-indol-3-yl)-2,2-dimethylpropan-1-ol |
| InChIKey | SQGJRSORSBXTHT-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CNC2=C1C=C(C=C2)Br)CO |
Computed by PubChem (NCBI)