Products 2641604-92-2
CAS 2641604-92-2 is the registry number for 5–methoxy DMT (fumarate). Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
(E)-but-2-enedioic acid;2-(5-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine (CAS 2641604-92-2) is a chemical compound with the molecular formula C17H22N2O5 and a molecular weight of 334.4 g/mol. IUPAC name: (E)-but-2-enedioic acid;2-(5-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine. InChIKey: AAZUHZAFFHIHLI-WLHGVMLRSA-N.
| Molecular formula | C17H22N2O5 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;2-(5-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine |
| InChIKey | AAZUHZAFFHIHLI-WLHGVMLRSA-N |
| SMILES | CN(C)CCC1=CNC2=C1C=C(C=C2)OC.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-methoxy DMT (fumarate)