CAS 2641807-60-3 is the registry number for Ethyl 5-(2-methyl-1-oxopropan-2-yl)-1,3,4-oxadiazole-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-(2-methyl-1-oxopropan-2-yl)-1,3,4-oxadiazole-2-carboxylate (CAS 2641807-60-3) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: ethyl 5-(2-methyl-1-oxopropan-2-yl)-1,3,4-oxadiazole-2-carboxylate. InChIKey: RPYIGBPIJBBNBC-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | ethyl 5-(2-methyl-1-oxopropan-2-yl)-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | RPYIGBPIJBBNBC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN=C(O1)C(C)(C)C=O |
Computed by PubChem (NCBI)