Products 2641915-33-3
CAS 2641915-33-3 is the registry number for Methyl (2R,3R)-2-methylpiperidine-3-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R,3R)-2-methylpiperidine-3-carboxylate;hydrochloride (CAS 2641915-33-3) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (2R,3R)-2-methylpiperidine-3-carboxylate;hydrochloride. InChIKey: VPKPUDLZDYZDRS-ZJLYAJKPSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | methyl (2R,3R)-2-methylpiperidine-3-carboxylate;hydrochloride |
| InChIKey | VPKPUDLZDYZDRS-ZJLYAJKPSA-N |
| SMILES | C[C@@H]1[C@@H](CCCN1)C(=O)OC.Cl |
Computed by PubChem (NCBI)
Synonyms:
Methyl (2R,3R)-2-methylpiperidine-3-carboxylate hydrochloride, cis-2-Methyl-piperidine-3-carboxylic acid methyl ester hydrochloride, methyl (2R,3R)-2-methylpiperidine-3-carboxylate;hydrochloride, (2R,3R)-2-Methyl-piperidine-3-carboxylic acid methyl ester HCl, Rel-methyl (2R,3R)-2-methylpiperidine-3-carboxylate hydrochloride