Products 26420-27-9

CAS 26420-27-9 is the registry number for 4-(2,5-Dimethylthiophen-3-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-(2,5-dimethylthiophen-3-yl)butanoic acid (CAS 26420-27-9) is a chemical compound with the molecular formula C10H14O2S and a molecular weight of 198.28 g/mol. IUPAC name: 4-(2,5-dimethylthiophen-3-yl)butanoic acid. InChIKey: RSLTWBYDRVPLDX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14O2S
Molecular weight198.28 g/mol
IUPAC name4-(2,5-dimethylthiophen-3-yl)butanoic acid
InChIKeyRSLTWBYDRVPLDX-UHFFFAOYSA-N
SMILESCC1=CC(=C(S1)C)CCCC(=O)O

Computed by PubChem (NCBI)