CAS 6462-31-3 appears in our catalog under these names: 2-Methanesulfonyl-1,3,5-trimethylbenzene, 95%, 2-Methanesulfonyl-1,3,5-trimethylbenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1,3,5-trimethyl-2-methylsulfonylbenzene (CAS 6462-31-3) is a chemical compound with the molecular formula C10H14O2S and a molecular weight of 198.28 g/mol. IUPAC name: 1,3,5-trimethyl-2-methylsulfonylbenzene. InChIKey: VTSJEUVPFFSEBN-UHFFFAOYSA-N.
| Molecular formula | C10H14O2S |
|---|---|
| Molecular weight | 198.28 g/mol |
| IUPAC name | 1,3,5-trimethyl-2-methylsulfonylbenzene |
| InChIKey | VTSJEUVPFFSEBN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)C)C |
Computed by PubChem (NCBI)