CAS 957029-02-6 appears in our catalog under these names: 2,3,5,6-Tetramethylbenzenesulfinic acid, 95%, 2,3,5,6-Tetramethylbenzene-1-sulfinic acid, 95%, 2,3,5,6-Tetramethylbenzene-1-sulfinic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2,3,5,6-tetramethylbenzenesulfinic acid (CAS 957029-02-6) is a chemical compound with the molecular formula C10H14O2S and a molecular weight of 198.28 g/mol. IUPAC name: 2,3,5,6-tetramethylbenzenesulfinic acid. InChIKey: XCIGFRWYJNLLQP-UHFFFAOYSA-N.
| Molecular formula | C10H14O2S |
|---|---|
| Molecular weight | 198.28 g/mol |
| IUPAC name | 2,3,5,6-tetramethylbenzenesulfinic acid |
| InChIKey | XCIGFRWYJNLLQP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)O)C)C |
Computed by PubChem (NCBI)