Products 2642222-62-4

CAS 2642222-62-4 is the registry number for 8-(trifluoromethyl)quinoline-6-carboxylic acid, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

1-(3-ethoxy-3-oxopropyl)pyrazole-3-carboxylic acid (CAS 2642222-62-4) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: 1-(3-ethoxy-3-oxopropyl)pyrazole-3-carboxylic acid. InChIKey: KRPTWDUNXRTZLG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12N2O4
Molecular weight212.20 g/mol
IUPAC name1-(3-ethoxy-3-oxopropyl)pyrazole-3-carboxylic acid
InChIKeyKRPTWDUNXRTZLG-UHFFFAOYSA-N
SMILESCCOC(=O)CCN1C=CC(=N1)C(=O)O

Computed by PubChem (NCBI)