Products 264229-33-6
CAS 264229-33-6 is the registry number for rac-1-tert-Butyl 3-ethyl (3R,4S)-4-(benzylamino)piperidine-1,3-dicarboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-O-tert-butyl 3-O-ethyl (3R,4S)-4-(benzylamino)piperidine-1,3-dicarboxylate (CAS 264229-33-6) is a chemical compound with the molecular formula C20H30N2O4 and a molecular weight of 362.5 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3R,4S)-4-(benzylamino)piperidine-1,3-dicarboxylate. InChIKey: CRHKYBPMCRSTHO-SJORKVTESA-N.
| Molecular formula | C20H30N2O4 |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3R,4S)-4-(benzylamino)piperidine-1,3-dicarboxylate |
| InChIKey | CRHKYBPMCRSTHO-SJORKVTESA-N |
| SMILES | CCOC(=O)[C@@H]1CN(CC[C@@H]1NCC2=CC=CC=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)