Products 27508-24-3
CAS 27508-24-3 appears in our catalog under these names: 3-Ethyl-1-benzothiophene-2-carboxylic acid, 3-Ethyl-1-benzothiophene-2-carboxylic acid, 95%, 3-Ethylbenzo[b]thiophene-2-carboxylic acid, 98%, 3-Ethyl-1-benzothiophene-2-carboxylic acid, 98%, 98%. Offered by: Biosynth, AmBeed, Fluorochem, Chemat. Available pack sizes: 50mg, 0,5g, 5g, 100mg, 250mg, 500mg, 1g, 10g.
3-ethyl-1-benzothiophene-2-carboxylic acid (CAS 27508-24-3) is a chemical compound with the molecular formula C11H10O2S and a molecular weight of 206.26 g/mol. IUPAC name: 3-ethyl-1-benzothiophene-2-carboxylic acid. InChIKey: AZVOTTRTPMDKHP-UHFFFAOYSA-N.
| Molecular formula | C11H10O2S |
|---|---|
| Molecular weight | 206.26 g/mol |
| IUPAC name | 3-ethyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | AZVOTTRTPMDKHP-UHFFFAOYSA-N |
| SMILES | CCC1=C(SC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)