CAS 2648453-65-8 is the registry number for 5-Bromo-4-chlorothieno[2,3-b]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-4-chlorothieno[2,3-b]pyridine (CAS 2648453-65-8) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: 5-bromo-4-chlorothieno[2,3-b]pyridine. InChIKey: YXMGOQGGXONFGJ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | 5-bromo-4-chlorothieno[2,3-b]pyridine |
| InChIKey | YXMGOQGGXONFGJ-UHFFFAOYSA-N |
| SMILES | C1=CSC2=NC=C(C(=C21)Cl)Br |
Computed by PubChem (NCBI)