CAS 2649788-96-3 is the registry number for 5-Amino-4,6-dichloroisobenzofuran-1(3H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-4,6-dichloro-3H-2-benzofuran-1-one (CAS 2649788-96-3) is a chemical compound with the molecular formula C8H5Cl2NO2 and a molecular weight of 218.03 g/mol. IUPAC name: 5-amino-4,6-dichloro-3H-2-benzofuran-1-one. InChIKey: YOJVCGUDXLMUFB-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO2 |
|---|---|
| Molecular weight | 218.03 g/mol |
| IUPAC name | 5-amino-4,6-dichloro-3H-2-benzofuran-1-one |
| InChIKey | YOJVCGUDXLMUFB-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=C(C=C2C(=O)O1)Cl)N)Cl |
Computed by PubChem (NCBI)